![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - |
![[TXT]](/icons/text.gif) | 1911 student list.txt | 22-Apr-2007 19:29 | 1.3K |
![[IMG]](/icons/image2.gif) | C_Sun_Feb_16_19111.JPG | 29-Aug-2005 07:08 | 1.4M |
![[IMG]](/icons/image2.gif) | Pict06581.JPG | 07-Sep-2005 08:48 | 2.3M |
![[IMG]](/icons/image2.gif) | Pict06601.JPG | 07-Sep-2005 08:48 | 1.4M |
![[IMG]](/icons/image2.gif) | Pict06611.JPG | 07-Sep-2005 09:54 | 1.1M |
![[DIR]](/icons/folder.gif) | _vti_cnf/ | 20-Aug-2005 05:55 | - |
![[TXT]](/icons/text.gif) | all school directors 1899.txt | 23-Apr-2007 11:16 | 1.9K |
![[TXT]](/icons/text.gif) | alvina launch spring 1904.txt | 27-Nov-2007 00:16 | 472 |
![[TXT]](/icons/text.gif) | anderson, rodney in pacific.txt | 15-Jan-2007 15:05 | 896 |
![[TXT]](/icons/text.gif) | anderson boys accident.txt | 15-Jan-2007 15:05 | 1.7K |
![[TXT]](/icons/text.gif) | applied naturalization april 1910.txt | 23-Feb-2008 12:26 | 577 |
![[TXT]](/icons/text.gif) | apt of john hughes as auditor.txt | 03-Mar-2008 00:16 | 759 |
![[TXT]](/icons/text.gif) | athens promotion.txt | 22-Apr-2007 19:27 | 20K |
![[TXT]](/icons/text.gif) | bradley, harold lietenancy army.txt | 23-Feb-2008 12:26 | 437 |
![[TXT]](/icons/text.gif) | brix family.txt | 24-Nov-2007 12:56 | 5.7K |
![[TXT]](/icons/text.gif) | cath baseball team 1911.txt | 03-Mar-2008 00:16 | 428 |
![[TXT]](/icons/text.gif) | cath quillis tribe 60.txt | 29-Jan-2008 12:43 | 1.1K |
![[TXT]](/icons/text.gif) | cath timber co cook fired.txt | 29-Jan-2008 12:43 | 1.0K |
![[TXT]](/icons/text.gif) | cath to skam highway completed.txt | 15-Feb-2008 20:26 | 1.7K |
![[TXT]](/icons/text.gif) | chemawa indian 1908.txt | 13-May-2007 21:44 | 652 |
![[TXT]](/icons/text.gif) | county fair petition abt 1911.txt | 09-Sep-2007 22:45 | 1.0K |
![[TXT]](/icons/text.gif) | county roll of honor pledges wwi.txt | 29-Jan-2008 12:43 | 3.4K |
![[TXT]](/icons/text.gif) | court complaints.txt | 23-Feb-2008 12:26 | 1.1K |
![[TXT]](/icons/text.gif) | crippen, h o farm.txt | 03-Mar-2008 00:16 | 694 |
![[TXT]](/icons/text.gif) | diking district 1.txt | 29-Jan-2008 12:43 | 1.1K |
![[TXT]](/icons/text.gif) | draft wwi.txt | 29-Jan-2008 12:43 | 1.0K |
![[TXT]](/icons/text.gif) | dr peacock death of madeline longtain.txt | 03-Mar-2008 00:16 | 330 |
![[TXT]](/icons/text.gif) | dyking pugetisland.txt | 13-May-2007 21:35 | 1.0K |
![[TXT]](/icons/text.gif) | eagle july 27 1914 summons.txt | 15-Jan-2007 15:09 | 2.0K |
![[TXT]](/icons/text.gif) | early days of elochoman valley.txt | 27-Nov-2007 00:16 | 3.7K |
![[TXT]](/icons/text.gif) | edal, lyle boating accident.txt | 22-Apr-2007 19:27 | 1.0K |
![[TXT]](/icons/text.gif) | finlayson, john sup of brookfield.txt | 15-Feb-2008 20:26 | 326 |
![[TXT]](/icons/text.gif) | flag1945.htm | 23-Aug-2005 06:17 | 3.3K |
![[TXT]](/icons/text.gif) | foster, jj biography.txt | 22-Apr-2007 19:27 | 1.2K |
![[TXT]](/icons/text.gif) | foster, jj reunion.txt | 09-Sep-2007 22:49 | 3.4K |
![[IMG]](/icons/image2.gif) | foster50th.jpg | 23-Aug-2005 06:17 | 88K |
![[TXT]](/icons/text.gif) | franchise granted.txt | 15-Feb-2008 20:26 | 1.1K |
![[TXT]](/icons/text.gif) | frozen.htm | 07-Sep-2005 08:47 | 1.0K |
![[TXT]](/icons/text.gif) | graysriver builder.htm | 13-May-2007 21:28 | 11K |
![[TXT]](/icons/text.gif) | houchen, minnie and family whooping cough.txt | 03-Mar-2008 00:16 | 422 |
![[TXT]](/icons/text.gif) | hougen, emmery torpedoed.txt | 23-Feb-2008 12:26 | 5.7K |
![[TXT]](/icons/text.gif) | howell shingle company 1904.txt | 09-Sep-2007 22:49 | 778 |
![[TXT]](/icons/text.gif) | insanity cases waranka and lake.txt | 23-Feb-2008 12:26 | 893 |
![[TXT]](/icons/text.gif) | jacobsen, martin capt retires.txt | 23-Feb-2008 12:26 | 442 |
![[TXT]](/icons/text.gif) | kalb, ha alder creek camp.txt | 23-Feb-2008 12:26 | 313 |
![[TXT]](/icons/text.gif) | lc eagle 9 12 1956.txt | 13-May-2007 21:31 | 1.9K |
![[TXT]](/icons/text.gif) | lc eagle sept 12 1956.txt | 13-May-2007 21:35 | 1.9K |
![[TXT]](/icons/text.gif) | linquist congdon wedding.txt | 15-Feb-2008 20:26 | 609 |
![[TXT]](/icons/text.gif) | mickey's tavern softball team.txt | 22-Apr-2007 19:27 | 1.2K |
![[TXT]](/icons/text.gif) | military 10 19 1944.txt | 27-Nov-2007 00:16 | 1.4K |
![[TXT]](/icons/text.gif) | new rock quarry april 1910.txt | 23-Feb-2008 12:26 | 694 |
![[TXT]](/icons/text.gif) | olmstead, richard shots wild cat.txt | 03-Mar-2008 00:16 | 314 |
![[TXT]](/icons/text.gif) | patriotic rally.txt | 29-Jan-2008 12:43 | 3.8K |
![[TXT]](/icons/text.gif) | petition rbt irving 1916 for sheriff.txt | 09-Sep-2007 22:45 | 402 |
![[TXT]](/icons/text.gif) | pioneerassoc memorials 1965.txt | 15-Feb-2008 20:28 | 535 |
![[TXT]](/icons/text.gif) | pioneers_memorial.htm | 13-May-2007 21:31 | 4.8K |
![[TXT]](/icons/text.gif) | river gosip april 1910.txt | 23-Feb-2008 12:27 | 437 |
![[TXT]](/icons/text.gif) | river gossip april 1911.txt | 23-Feb-2008 12:27 | 1.1K |
![[TXT]](/icons/text.gif) | sallys well.txt | 15-Jan-2007 15:09 | 751 |
![[TXT]](/icons/text.gif) | senior1945.htm | 23-Aug-2005 06:17 | 8.0K |
![[TXT]](/icons/text.gif) | skam altoona baseball 1904.txt | 09-Sep-2007 22:49 | 1.2K |
![[TXT]](/icons/text.gif) | skam creamery john iverson1904.txt | 27-Nov-2007 00:16 | 801 |
![[IMG]](/icons/image2.gif) | skamokawa_school_1935.jpg | 13-May-2007 21:44 | 134K |
![[TXT]](/icons/text.gif) | skamokawa news april 1910.txt | 23-Feb-2008 12:27 | 861 |
![[TXT]](/icons/text.gif) | thornton and ingalls marriage.txt | 15-Feb-2008 20:28 | 420 |
![[ ]](/icons/unknown.gif) | vets of wwi charter.doc | 09-Mar-2008 18:03 | 34K |
![[TXT]](/icons/text.gif) | vog widows pension.txt | 29-Jan-2008 12:43 | 1.1K |
![[TXT]](/icons/text.gif) | wa ki hi 1929.txt | 15-Feb-2008 20:28 | 5.0K |
![[TXT]](/icons/text.gif) | wa ki hi alumni 1917 to 1928.txt | 15-Feb-2008 20:28 | 2.9K |
![[TXT]](/icons/text.gif) | warren, charles cath centennial article.txt | 09-Mar-2008 18:03 | 2.7K |
![[TXT]](/icons/text.gif) | whitten vs silverman.txt | 29-Jan-2008 12:43 | 1.1K |
![[TXT]](/icons/text.gif) | wikjord, gerhard intension.txt | 29-Jan-2008 12:43 | 961 |
![[TXT]](/icons/text.gif) | wirkkala, henry moves to finland.txt | 03-Mar-2008 00:16 | 320 |
![[TXT]](/icons/text.gif) | witham, walter e retirement.txt | 27-Nov-2007 00:16 | 1.8K |
![[IMG]](/icons/image2.gif) | wwiandii military.jpg | 13-May-2007 21:31 | 815K |
![[IMG]](/icons/image2.gif) | wwi deaths.jpg | 13-May-2007 21:31 | 1.3M |
|